C12H22OS2 — CID 58210289
2,5-diethyl-3-(2-methyl-1,3-dithiolan-2-yl)oxolane (PubChem CID 58210289) has the molecular formula C12H22OS2 and a molecular weight of 246.44 g/mol. Its IUPAC name is 2,5-diethyl-3-(2-methyl-1,3-dithiolan-2-yl)oxolane.
| Compound Name | 2,5-diethyl-3-(2-methyl-1,3-dithiolan-2-yl)oxolane |
|---|---|
| PubChem CID | 58210289 |
| Molecular Formula | C12H22OS2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2,5-diethyl-3-(2-methyl-1,3-dithiolan-2-yl)oxolane |
| SMILES | CCC1CC(C2(C)SCCS2)C(CC)O1 |
| InChI | InChI=1S/C12H22OS2/c1-4-9-8-10(11(5-2)13-9)12(3)14-6-7-15-12/h9-11H,4-8H2,1-3H3 |
| InChIKey | VLIYOYIFJALFOY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |