C21H19N3O2S — CID 58211685
[4-[6-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2-pyridinyl]phenyl]methanimine (PubChem CID 58211685) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is [4-[6-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2-pyridinyl]phenyl]methanimine.
| Compound Name | [4-[6-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2-pyridinyl]phenyl]methanimine |
|---|---|
| PubChem CID | 58211685 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | [4-[6-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2-pyridinyl]phenyl]methanimine |
| SMILES | [H]/N=C/c1ccc(-c2cccc(S(=O)(=O)N3CCc4ccccc4C3)n2)cc1 |
| InChI | InChI=1S/C21H19N3O2S/c22-14-16-8-10-18(11-9-16)20-6-3-7-21(23-20)27(25,26)24-13-12-17-4-1-2-5-19(17)15-24/h1-11,14,22H,12-13,15H2/b22-14+ |
| InChIKey | UEKTXZCYXCYIED-HYARGMPZSA-N |
| XLogP | 3.49 |
| TPSA | 74.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|