C15H16N4O2S — CID 89050921
7-(benzenesulfonyl)-4-methanimidoyl-6,8-dihydro-5H-2,7-naphthyridin-3-amine (PubChem CID 89050921) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-4-methanimidoyl-6,8-dihydro-5H-2,7-naphthyridin-3-amine.
| Compound Name | 7-(benzenesulfonyl)-4-methanimidoyl-6,8-dihydro-5H-2,7-naphthyridin-3-amine |
|---|---|
| PubChem CID | 89050921 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 7-(benzenesulfonyl)-4-methanimidoyl-6,8-dihydro-5H-2,7-naphthyridin-3-amine |
| SMILES | [H]/N=C/c1c(N)ncc2c1CCN(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C15H16N4O2S/c16-8-14-13-6-7-19(10-11(13)9-18-15(14)17)22(20,21)12-4-2-1-3-5-12/h1-5,8-9,16H,6-7,10H2,(H2,17,18)/b16-8+ |
| InChIKey | MKMCTOSHENYILZ-LZYBPNLTSA-N |
| XLogP | 1.41 |
| TPSA | 100.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|