C15H14F2N4O2S — CID 89050949
7-(2,4-difluorophenyl)sulfonyl-4-methanimidoyl-6,8-dihydro-5H-2,7-naphthyridin-3-amine (PubChem CID 89050949) has the molecular formula C15H14F2N4O2S and a molecular weight of 352.37 g/mol. Its IUPAC name is 7-(2,4-difluorophenyl)sulfonyl-4-methanimidoyl-6,8-dihydro-5H-2,7-naphthyridin-3-amine.
| Compound Name | 7-(2,4-difluorophenyl)sulfonyl-4-methanimidoyl-6,8-dihydro-5H-2,7-naphthyridin-3-amine |
|---|---|
| PubChem CID | 89050949 |
| Molecular Formula | C15H14F2N4O2S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 7-(2,4-difluorophenyl)sulfonyl-4-methanimidoyl-6,8-dihydro-5H-2,7-naphthyridin-3-amine |
| SMILES | [H]/N=C/c1c(N)ncc2c1CCN(S(=O)(=O)c1ccc(F)cc1F)C2 |
| InChI | InChI=1S/C15H14F2N4O2S/c16-10-1-2-14(13(17)5-10)24(22,23)21-4-3-11-9(8-21)7-20-15(19)12(11)6-18/h1-2,5-7,18H,3-4,8H2,(H2,19,20)/b18-6+ |
| InChIKey | XFLRSEKWICVMCT-NGYBGAFCSA-N |
| XLogP | 1.69 |
| TPSA | 100.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|