C24H21F3N8O5S — CID 58216486
N-(4-methylsulfonylphenyl)-5-nitro-6-[4-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]piperazin-1-yl]pyrimidin-4-amine (PubChem CID 58216486) has the molecular formula C24H21F3N8O5S and a molecular weight of 590.54 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-5-nitro-6-[4-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-(4-methylsulfonylphenyl)-5-nitro-6-[4-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 58216486 |
| Molecular Formula | C24H21F3N8O5S |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-5-nitro-6-[4-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]piperazin-1-yl]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncnc(N3CCN(c4nc(-c5cccc(C(F)(F)F)c5)no4)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H21F3N8O5S/c1-41(38,39)18-7-5-17(6-8-18)30-21-19(35(36)37)22(29-14-28-21)33-9-11-34(12-10-33)23-31-20(32-40-23)15-3-2-4-16(13-15)24(25,26)27/h2-8,13-14H,9-12H2,1H3,(H,28,29,30) |
| InChIKey | SZTXAUIAXVYCIU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|