C21H28N6O7S — CID 87931301
6-[4-[5-(2-methylpropyl)-1,2,4,3-trioxazolidin-5-yl]piperidin-1-yl]-N-(4-methylsulfonylphenyl)-5-nitropyrimidin-4-amine (PubChem CID 87931301) has the molecular formula C21H28N6O7S and a molecular weight of 508.56 g/mol. Its IUPAC name is 6-[4-[5-(2-methylpropyl)-1,2,4,3-trioxazolidin-5-yl]piperidin-1-yl]-N-(4-methylsulfonylphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-[5-(2-methylpropyl)-1,2,4,3-trioxazolidin-5-yl]piperidin-1-yl]-N-(4-methylsulfonylphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 87931301 |
| Molecular Formula | C21H28N6O7S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 6-[4-[5-(2-methylpropyl)-1,2,4,3-trioxazolidin-5-yl]piperidin-1-yl]-N-(4-methylsulfonylphenyl)-5-nitropyrimidin-4-amine |
| SMILES | CC(C)CC1(C2CCN(c3ncnc(Nc4ccc(S(C)(=O)=O)cc4)c3[N+](=O)[O-])CC2)ONOO1 |
| InChI | InChI=1S/C21H28N6O7S/c1-14(2)12-21(32-25-34-33-21)15-8-10-26(11-9-15)20-18(27(28)29)19(22-13-23-20)24-16-4-6-17(7-5-16)35(3,30)31/h4-7,13-15,25H,8-12H2,1-3H3,(H,22,23,24) |
| InChIKey | RIOXQDMOSRZIAB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|