C23H42N2O4 — CID 58223951
8-methyl-N-[9-[methyl(propan-2-yl)amino]-2,9-dioxononyl]-7-oxononanamide (PubChem CID 58223951) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is 8-methyl-N-[9-[methyl(propan-2-yl)amino]-2,9-dioxononyl]-7-oxononanamide.
| Compound Name | 8-methyl-N-[9-[methyl(propan-2-yl)amino]-2,9-dioxononyl]-7-oxononanamide |
|---|---|
| PubChem CID | 58223951 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | 8-methyl-N-[9-[methyl(propan-2-yl)amino]-2,9-dioxononyl]-7-oxononanamide |
| SMILES | CC(C)C(=O)CCCCCC(=O)NCC(=O)CCCCCCC(=O)N(C)C(C)C |
| InChI | InChI=1S/C23H42N2O4/c1-18(2)21(27)14-10-8-11-15-22(28)24-17-20(26)13-9-6-7-12-16-23(29)25(5)19(3)4/h18-19H,6-17H2,1-5H3,(H,24,28) |
| InChIKey | STFWKBBNEAFZKT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|