C38H59N3O7 — CID 58223960
N,N'-dimethyl-N'-[4-[2-oxo-2-(2-oxocyclohexyl)ethyl]phenyl]-N-[2-[4-oxo-4-(5-propanoyldecylamino)butoxy]ethyl]propanediamide (PubChem CID 58223960) has the molecular formula C38H59N3O7 and a molecular weight of 669.90 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[4-[2-oxo-2-(2-oxocyclohexyl)ethyl]phenyl]-N-[2-[4-oxo-4-(5-propanoyldecylamino)butoxy]ethyl]propanediamide.
| Compound Name | N,N'-dimethyl-N'-[4-[2-oxo-2-(2-oxocyclohexyl)ethyl]phenyl]-N-[2-[4-oxo-4-(5-propanoyldecylamino)butoxy]ethyl]propanediamide |
|---|---|
| PubChem CID | 58223960 |
| Molecular Formula | C38H59N3O7 |
| Molecular Weight | 669.90 g/mol |
| Exact Mass | 669.44 |
| IUPAC Name | N,N'-dimethyl-N'-[4-[2-oxo-2-(2-oxocyclohexyl)ethyl]phenyl]-N-[2-[4-oxo-4-(5-propanoyldecylamino)butoxy]ethyl]propanediamide |
| SMILES | CCCCCC(CCCCNC(=O)CCCOCCN(C)C(=O)CC(=O)N(C)c1ccc(CC(=O)C2CCCCC2=O)cc1)C(=O)CC |
| InChI | InChI=1S/C38H59N3O7/c1-5-7-8-14-30(33(42)6-2)15-11-12-23-39-36(45)18-13-25-48-26-24-40(3)37(46)28-38(47)41(4)31-21-19-29(20-22-31)27-35(44)32-16-9-10-17-34(32)43/h19-22,30,32H,5-18,23-28H2,1-4H3,(H,39,45) |
| InChIKey | RASZSURKFCFEKK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.90 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|