C22H33N3O3 — CID 58229067
(1S)-1-[4-[bis(2-methoxyethyl)amino]phenyl]-N'-[(4-methoxyphenyl)methyl]ethane-1,2-diamine (PubChem CID 58229067) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is (1S)-1-[4-[bis(2-methoxyethyl)amino]phenyl]-N'-[(4-methoxyphenyl)methyl]ethane-1,2-diamine.
| Compound Name | (1S)-1-[4-[bis(2-methoxyethyl)amino]phenyl]-N'-[(4-methoxyphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58229067 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (1S)-1-[4-[bis(2-methoxyethyl)amino]phenyl]-N'-[(4-methoxyphenyl)methyl]ethane-1,2-diamine |
| SMILES | COCCN(CCOC)c1ccc([C@H](N)CNCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H33N3O3/c1-26-14-12-25(13-15-27-2)20-8-6-19(7-9-20)22(23)17-24-16-18-4-10-21(28-3)11-5-18/h4-11,22,24H,12-17,23H2,1-3H3/t22-/m1/s1 |
| InChIKey | HEYOBFLQNBFFEU-JOCHJYFZSA-N |
| XLogP | 2.58 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|