C27H27ClFN5O2S — CID 58229486
N-[2-chloro-5-[3-(3-piperidin-1-ylpropyl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 58229486) has the molecular formula C27H27ClFN5O2S and a molecular weight of 540.06 g/mol. Its IUPAC name is N-[2-chloro-5-[3-(3-piperidin-1-ylpropyl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[3-(3-piperidin-1-ylpropyl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 58229486 |
| Molecular Formula | C27H27ClFN5O2S |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | N-[2-chloro-5-[3-(3-piperidin-1-ylpropyl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3ncc(CCCN4CCCCC4)nc3c2)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H27ClFN5O2S/c28-27-26(33-37(35,36)23-9-7-21(29)8-10-23)16-20(17-31-27)19-6-11-24-25(15-19)32-22(18-30-24)5-4-14-34-12-2-1-3-13-34/h6-11,15-18,33H,1-5,12-14H2 |
| InChIKey | FQSIFTUYJGPPTH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|