C27H26ClFN4O2S — CID 58229490
N-[2-chloro-5-[3-(2-cyclohexylethyl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 58229490) has the molecular formula C27H26ClFN4O2S and a molecular weight of 525.05 g/mol. Its IUPAC name is N-[2-chloro-5-[3-(2-cyclohexylethyl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[3-(2-cyclohexylethyl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 58229490 |
| Molecular Formula | C27H26ClFN4O2S |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | N-[2-chloro-5-[3-(2-cyclohexylethyl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3ncc(CCC4CCCCC4)nc3c2)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H26ClFN4O2S/c28-27-26(33-36(34,35)23-11-8-21(29)9-12-23)15-20(16-31-27)19-7-13-24-25(14-19)32-22(17-30-24)10-6-18-4-2-1-3-5-18/h7-9,11-18,33H,1-6,10H2 |
| InChIKey | BOVVAECURRIWGY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|