C28H21ClF2N4O2S — CID 58229513
N-[2-chloro-5-[3-[2-(4-fluorophenyl)propyl]quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 58229513) has the molecular formula C28H21ClF2N4O2S and a molecular weight of 551.02 g/mol. Its IUPAC name is N-[2-chloro-5-[3-[2-(4-fluorophenyl)propyl]quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[3-[2-(4-fluorophenyl)propyl]quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 58229513 |
| Molecular Formula | C28H21ClF2N4O2S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | N-[2-chloro-5-[3-[2-(4-fluorophenyl)propyl]quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | CC(Cc1cnc2ccc(-c3cnc(Cl)c(NS(=O)(=O)c4ccc(F)cc4)c3)cc2n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H21ClF2N4O2S/c1-17(18-2-5-21(30)6-3-18)12-23-16-32-25-11-4-19(13-26(25)34-23)20-14-27(28(29)33-15-20)35-38(36,37)24-9-7-22(31)8-10-24/h2-11,13-17,35H,12H2,1H3 |
| InChIKey | GHAMUJKKUUJUEK-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|