About oxidanium;sodium;(1-methylpiperidin-4-yl)methanone
oxidanium;sodium;(1-methylpiperidin-4-yl)methanone (PubChem CID 58229802) has the molecular formula C7H15NNaO2+
and a molecular weight of 168.19 g/mol. Its IUPAC name is oxidanium;sodium;(1-methylpiperidin-4-yl)methanone.
Molecular Properties
| Compound Name | oxidanium;sodium;(1-methylpiperidin-4-yl)methanone |
| PubChem CID | 58229802 |
| Molecular Formula | C7H15NNaO2+ |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | oxidanium;sodium;(1-methylpiperidin-4-yl)methanone |
| SMILES | CN1CCC([C-]=O)CC1.[Na+].[OH3+] |
| InChI | InChI=1S/C7H12NO.Na.H2O/c1-8-4-2-7(6-9)3-5-8;;/h7H,2-5H2,1H3;;1H2/q-1;+1;/p+1 |
| InChIKey | BESLZIWCSNXNDT-UHFFFAOYSA-O |
| XLogP | -3.48 |
| TPSA | 53.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze oxidanium;sodium;(1-methylpiperidin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxidanium;sodium;(1-methylpiperidin-4-yl)methanone?
The IUPAC name of oxidanium;sodium;(1-methylpiperidin-4-yl)methanone (CID 58229802) is oxidanium;sodium;(1-methylpiperidin-4-yl)methanone.
What is the SMILES notation for oxidanium;sodium;(1-methylpiperidin-4-yl)methanone?
The canonical SMILES for oxidanium;sodium;(1-methylpiperidin-4-yl)methanone is CN1CCC([C-]=O)CC1.[Na+].[OH3+].
What is the InChIKey of oxidanium;sodium;(1-methylpiperidin-4-yl)methanone?
The InChIKey is BESLZIWCSNXNDT-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H12NO.Na.H2O/c1-8-4-2-7(6-9)3-5-8;;/h7H,2-5H2,1H3;;1H2/q-1;+1;/p+1.
What are the key properties of oxidanium;sodium;(1-methylpiperidin-4-yl)methanone?
oxidanium;sodium;(1-methylpiperidin-4-yl)methanone has a molecular weight of 168.19 g/mol, XLogP of -3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxidanium;sodium;(1-methylpiperidin-4-yl)methanone is sourced from PubChem (CID 58229802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).