C37H47ClN6O11 — CID 58232709
5-[[2-[1-(4-chlorobenzoyl)-5-methoxyindol-3-yl]acetyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid (PubChem CID 58232709) has the molecular formula C37H47ClN6O11 and a molecular weight of 787.27 g/mol. Its IUPAC name is 5-[[2-[1-(4-chlorobenzoyl)-5-methoxyindol-3-yl]acetyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid.
| Compound Name | 5-[[2-[1-(4-chlorobenzoyl)-5-methoxyindol-3-yl]acetyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 58232709 |
| Molecular Formula | C37H47ClN6O11 |
| Molecular Weight | 787.27 g/mol |
| Exact Mass | 786.30 |
| IUPAC Name | 5-[[2-[1-(4-chlorobenzoyl)-5-methoxyindol-3-yl]acetyl]amino]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)cn2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C37H47ClN6O11/c1-55-28-8-9-30-29(20-28)26(21-44(30)36(52)25-4-6-27(38)7-5-25)19-32(45)39-10-2-3-31(37(53)54)43-17-15-41(23-34(48)49)13-11-40(22-33(46)47)12-14-42(16-18-43)24-35(50)51/h4-9,20-21,31H,2-3,10-19,22-24H2,1H3,(H,39,45)(H,46,47)(H,48,49)(H,50,51)(H,53,54) |
| InChIKey | USQHYIJEYROTED-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 222.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|