C33H30FN7O5S — CID 58236581
N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-[3-(1,3-oxazol-5-yl)phenyl]propanediamide (PubChem CID 58236581) has the molecular formula C33H30FN7O5S and a molecular weight of 655.71 g/mol. Its IUPAC name is N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-[3-(1,3-oxazol-5-yl)phenyl]propanediamide.
| Compound Name | N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-[3-(1,3-oxazol-5-yl)phenyl]propanediamide |
|---|---|
| PubChem CID | 58236581 |
| Molecular Formula | C33H30FN7O5S |
| Molecular Weight | 655.71 g/mol |
| Exact Mass | 655.20 |
| IUPAC Name | N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N'-[3-(1,3-oxazol-5-yl)phenyl]propanediamide |
| SMILES | COCCNCc1cnc(-c2cc3nccc(Oc4ccc(NC(=O)CC(=O)Nc5cccc(-c6cnco6)c5)cc4F)c3s2)n1C |
| InChI | InChI=1S/C33H30FN7O5S/c1-41-23(16-35-10-11-44-2)17-38-33(41)29-14-25-32(47-29)27(8-9-37-25)46-26-7-6-22(13-24(26)34)40-31(43)15-30(42)39-21-5-3-4-20(12-21)28-18-36-19-45-28/h3-9,12-14,17-19,35H,10-11,15-16H2,1-2H3,(H,39,42)(H,40,43) |
| InChIKey | XHFJMTCBNYUJSG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|