C9H5N3O2 — CID 582386
4-diazonio-3-phenyl-1,2-oxazol-5-olate (PubChem CID 582386) has the molecular formula C9H5N3O2 and a molecular weight of 187.16 g/mol. Its IUPAC name is 4-diazonio-3-phenyl-1,2-oxazol-5-olate.
| Compound Name | 4-diazonio-3-phenyl-1,2-oxazol-5-olate |
|---|---|
| PubChem CID | 582386 |
| Molecular Formula | C9H5N3O2 |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 4-diazonio-3-phenyl-1,2-oxazol-5-olate |
| SMILES | N#[N+]c1c(-c2ccccc2)noc1[O-] |
| InChI | InChI=1S/C9H5N3O2/c10-11-8-7(12-14-9(8)13)6-4-2-1-3-5-6/h1-5H |
| InChIKey | DZFBRZWIANVQAC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|