C12H12Br2O4 — CID 58245698
[4,5-bis(bromomethyl)-2-(formyloxymethyl)phenyl]methyl formate (PubChem CID 58245698) has the molecular formula C12H12Br2O4 and a molecular weight of 380.03 g/mol. Its IUPAC name is [4,5-bis(bromomethyl)-2-(formyloxymethyl)phenyl]methyl formate.
| Compound Name | [4,5-bis(bromomethyl)-2-(formyloxymethyl)phenyl]methyl formate |
|---|---|
| PubChem CID | 58245698 |
| Molecular Formula | C12H12Br2O4 |
| Molecular Weight | 380.03 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | [4,5-bis(bromomethyl)-2-(formyloxymethyl)phenyl]methyl formate |
| SMILES | O=COCc1cc(CBr)c(CBr)cc1COC=O |
| InChI | InChI=1S/C12H12Br2O4/c13-3-9-1-11(5-17-7-15)12(6-18-8-16)2-10(9)4-14/h1-2,7-8H,3-6H2 |
| InChIKey | HKPBXEREFVGWFB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.03 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|