C24H31ClN2O3S — CID 58246254
3-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]-N,N-dimethylpropane-1-sulfonamide (PubChem CID 58246254) has the molecular formula C24H31ClN2O3S and a molecular weight of 463.04 g/mol. Its IUPAC name is 3-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 3-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 58246254 |
| Molecular Formula | C24H31ClN2O3S |
| Molecular Weight | 463.04 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 3-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]-N,N-dimethylpropane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCCOc1ccc2c(c1)C(C1(c3ccc(Cl)cc3)CCC1)NCC2 |
| InChI | InChI=1S/C24H31ClN2O3S/c1-27(2)31(28,29)16-4-15-30-21-10-5-18-11-14-26-23(22(18)17-21)24(12-3-13-24)19-6-8-20(25)9-7-19/h5-10,17,23,26H,3-4,11-16H2,1-2H3 |
| InChIKey | GUKVMMYOQRVVAZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.04 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|