C24H34Cl2N2O3S — CID 169427626
7-(3-propylsulfonylpropoxy)-1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinoline;dihydrochloride (PubChem CID 169427626) has the molecular formula C24H34Cl2N2O3S and a molecular weight of 501.52 g/mol. Its IUPAC name is 7-(3-propylsulfonylpropoxy)-1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinoline;dihydrochloride.
| Compound Name | 7-(3-propylsulfonylpropoxy)-1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 169427626 |
| Molecular Formula | C24H34Cl2N2O3S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 7-(3-propylsulfonylpropoxy)-1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinoline;dihydrochloride |
| SMILES | CCCS(=O)(=O)CCCOc1ccc2c(c1)C(C1(c3ccccn3)CCC1)NCC2.Cl.Cl |
| InChI | InChI=1S/C24H32N2O3S.2ClH/c1-2-16-30(27,28)17-6-15-29-20-9-8-19-10-14-26-23(21(19)18-20)24(11-5-12-24)22-7-3-4-13-25-22;;/h3-4,7-9,13,18,23,26H,2,5-6,10-12,14-17H2,1H3;2*1H |
| InChIKey | JMJSBZLQRVSOFI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|