C25H33FN6O4S — CID 143871031
N-(1-aminoethenyl)-1-[(fluoroamino)-[2-[[1-[1-(4-hydroxyphenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]sulfamoyl]-N'-methylmethanimidamide (PubChem CID 143871031) has the molecular formula C25H33FN6O4S and a molecular weight of 532.64 g/mol. Its IUPAC name is N-(1-aminoethenyl)-1-[(fluoroamino)-[2-[[1-[1-(4-hydroxyphenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]sulfamoyl]-N'-methylmethanimidamide.
| Compound Name | N-(1-aminoethenyl)-1-[(fluoroamino)-[2-[[1-[1-(4-hydroxyphenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]sulfamoyl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 143871031 |
| Molecular Formula | C25H33FN6O4S |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | N-(1-aminoethenyl)-1-[(fluoroamino)-[2-[[1-[1-(4-hydroxyphenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]sulfamoyl]-N'-methylmethanimidamide |
| SMILES | C=C(N)N/C(=N\C)S(=O)(=O)N(CCOc1ccc2c(c1)C(C1(c3ccc(O)cc3)CCC1)NCC2)NF |
| InChI | InChI=1S/C25H33FN6O4S/c1-17(27)30-24(28-2)37(34,35)32(31-26)14-15-36-21-9-4-18-10-13-29-23(22(18)16-21)25(11-3-12-25)19-5-7-20(33)8-6-19/h4-9,16,23,29,31,33H,1,3,10-15,27H2,2H3,(H,28,30) |
| InChIKey | RUDBAVOFEHMZQP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|