C27H31N3O4S — CID 143871110
3-[[1-[1-(4-hydroxyphenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]-N-pyridin-2-ylpropane-1-sulfonamide (PubChem CID 143871110) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 3-[[1-[1-(4-hydroxyphenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]-N-pyridin-2-ylpropane-1-sulfonamide.
| Compound Name | 3-[[1-[1-(4-hydroxyphenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]-N-pyridin-2-ylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 143871110 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3-[[1-[1-(4-hydroxyphenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]-N-pyridin-2-ylpropane-1-sulfonamide |
| SMILES | O=S(=O)(CCCOc1ccc2c(c1)C(C1(c3ccc(O)cc3)CCC1)NCC2)Nc1ccccn1 |
| InChI | InChI=1S/C27H31N3O4S/c31-22-9-7-21(8-10-22)27(13-3-14-27)26-24-19-23(11-6-20(24)12-16-29-26)34-17-4-18-35(32,33)30-25-5-1-2-15-28-25/h1-2,5-11,15,19,26,29,31H,3-4,12-14,16-18H2,(H,28,30) |
| InChIKey | VTHGGNSZPONMLO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|