C25H33ClN2O3S — CID 58246387
N-[2-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]butane-1-sulfonamide (PubChem CID 58246387) has the molecular formula C25H33ClN2O3S and a molecular weight of 477.07 g/mol. Its IUPAC name is N-[2-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 58246387 |
| Molecular Formula | C25H33ClN2O3S |
| Molecular Weight | 477.07 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[2-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCOc1ccc2c(c1)C(C1(c3ccc(Cl)cc3)CCC1)NCC2 |
| InChI | InChI=1S/C25H33ClN2O3S/c1-2-3-17-32(29,30)28-15-16-31-22-10-5-19-11-14-27-24(23(19)18-22)25(12-4-13-25)20-6-8-21(26)9-7-20/h5-10,18,24,27-28H,2-4,11-17H2,1H3 |
| InChIKey | TYJNQYTZEHIJAV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.07 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|