C33H39FN2O2S — CID 143871068
N-[cyclobutylidene-(3-methylcyclohepta-1,4,6-trien-1-yl)-oxo-λ6-sulfanyl]-2-[[1-[1-(3-fluorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethanamine (PubChem CID 143871068) has the molecular formula C33H39FN2O2S and a molecular weight of 546.75 g/mol. Its IUPAC name is N-[cyclobutylidene-(3-methylcyclohepta-1,4,6-trien-1-yl)-oxo-λ6-sulfanyl]-2-[[1-[1-(3-fluorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethanamine.
| Compound Name | N-[cyclobutylidene-(3-methylcyclohepta-1,4,6-trien-1-yl)-oxo-λ6-sulfanyl]-2-[[1-[1-(3-fluorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 143871068 |
| Molecular Formula | C33H39FN2O2S |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | N-[cyclobutylidene-(3-methylcyclohepta-1,4,6-trien-1-yl)-oxo-λ6-sulfanyl]-2-[[1-[1-(3-fluorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethanamine |
| SMILES | CC1C=CC=CC(S(=O)(NCCOc2ccc3c(c2)C(C2(c4cccc(F)c4)CCC2)NCC3)=C2CCC2)=C1 |
| InChI | InChI=1S/C33H39FN2O2S/c1-24-7-2-3-10-30(21-24)39(37,29-11-5-12-29)36-19-20-38-28-14-13-25-15-18-35-32(31(25)23-28)33(16-6-17-33)26-8-4-9-27(34)22-26/h2-4,7-10,13-14,21-24,32,35H,5-6,11-12,15-20H2,1H3,(H,36,37) |
| InChIKey | GBPBTFXXLMVWPF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|