C21H27FN2O3S — CID 121273866
N-[2-[[1-[(3-fluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-2-benzazepin-8-yl]oxy]ethyl]ethanesulfonamide (PubChem CID 121273866) has the molecular formula C21H27FN2O3S and a molecular weight of 406.52 g/mol. Its IUPAC name is N-[2-[[1-[(3-fluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-2-benzazepin-8-yl]oxy]ethyl]ethanesulfonamide.
| Compound Name | N-[2-[[1-[(3-fluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-2-benzazepin-8-yl]oxy]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 121273866 |
| Molecular Formula | C21H27FN2O3S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[2-[[1-[(3-fluorophenyl)methyl]-2,3,4,5-tetrahydro-1H-2-benzazepin-8-yl]oxy]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCOc1ccc2c(c1)C(Cc1cccc(F)c1)NCCC2 |
| InChI | InChI=1S/C21H27FN2O3S/c1-2-28(25,26)24-11-12-27-19-9-8-17-6-4-10-23-21(20(17)15-19)14-16-5-3-7-18(22)13-16/h3,5,7-9,13,15,21,23-24H,2,4,6,10-12,14H2,1H3 |
| InChIKey | JEDNCSFCAOBIAU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|