C29H35FN2O3S — CID 58246201
1-[1-(4-fluorophenyl)cyclobutyl]-7-(3-propylsulfonylpropoxy)-2-(3H-pyrrol-2-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 58246201) has the molecular formula C29H35FN2O3S and a molecular weight of 510.68 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)cyclobutyl]-7-(3-propylsulfonylpropoxy)-2-(3H-pyrrol-2-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-[1-(4-fluorophenyl)cyclobutyl]-7-(3-propylsulfonylpropoxy)-2-(3H-pyrrol-2-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 58246201 |
| Molecular Formula | C29H35FN2O3S |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 1-[1-(4-fluorophenyl)cyclobutyl]-7-(3-propylsulfonylpropoxy)-2-(3H-pyrrol-2-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCS(=O)(=O)CCCOc1ccc2c(c1)C(C1(c3ccc(F)cc3)CCC1)N(C1=NC=CC1)CC2 |
| InChI | InChI=1S/C29H35FN2O3S/c1-2-19-36(33,34)20-5-18-35-25-12-7-22-13-17-32(27-6-3-16-31-27)28(26(22)21-25)29(14-4-15-29)23-8-10-24(30)11-9-23/h3,7-12,16,21,28H,2,4-6,13-15,17-20H2,1H3 |
| InChIKey | LNWDDKIRUKXQBU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|