C16H29NO3 — CID 58248913
(2R)-4,5,5,5-tetradeuterio-4-methyl-N-(3-methylbutyl)-2-[2-[(2S,3R)-3-methyloxiran-2-yl]-2-oxoethyl]pentanamide (PubChem CID 58248913) has the molecular formula C16H29NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is (2R)-4,5,5,5-tetradeuterio-4-methyl-N-(3-methylbutyl)-2-[2-[(2S,3R)-3-methyloxiran-2-yl]-2-oxoethyl]pentanamide.
| Compound Name | (2R)-4,5,5,5-tetradeuterio-4-methyl-N-(3-methylbutyl)-2-[2-[(2S,3R)-3-methyloxiran-2-yl]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 58248913 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (2R)-4,5,5,5-tetradeuterio-4-methyl-N-(3-methylbutyl)-2-[2-[(2S,3R)-3-methyloxiran-2-yl]-2-oxoethyl]pentanamide |
| SMILES | [2H]C([2H])([2H])C([2H])(C)CC(CC(=O)[C@H]1O[C@@H]1C)C(=O)NCCC(C)C |
| InChI | InChI=1S/C16H29NO3/c1-10(2)6-7-17-16(19)13(8-11(3)4)9-14(18)15-12(5)20-15/h10-13,15H,6-9H2,1-5H3,(H,17,19)/t12-,13?,15+/m1/s1/i3D3,11D/t11?,12-,13?,15+ |
| InChIKey | QXAXIVDGYOFNER-HGFBZODNSA-N |
| XLogP | 2.56 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|