C38H34N2O3 — CID 58252919
3',6'-bis[(2,4-dimethylphenyl)methylamino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 58252919) has the molecular formula C38H34N2O3 and a molecular weight of 566.70 g/mol. Its IUPAC name is 3',6'-bis[(2,4-dimethylphenyl)methylamino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis[(2,4-dimethylphenyl)methylamino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 58252919 |
| Molecular Formula | C38H34N2O3 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 3',6'-bis[(2,4-dimethylphenyl)methylamino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Cc1ccc(CNc2ccc3c(c2)Oc2cc(NCc4ccc(C)cc4C)ccc2C32OC(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C38H34N2O3/c1-23-9-11-27(25(3)17-23)21-39-29-13-15-33-35(19-29)42-36-20-30(40-22-28-12-10-24(2)18-26(28)4)14-16-34(36)38(33)32-8-6-5-7-31(32)37(41)43-38/h5-20,39-40H,21-22H2,1-4H3 |
| InChIKey | IIZFSXQSXOOFRQ-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|