C19H19NO4 — CID 58259517
[(1S,3S,4R,6S,7R,10S,11R)-10-hydroxy-5-methyl-12-oxa-5-azahexacyclo[9.7.0.01,7.03,17.04,6.013,18]octadeca-8,13,15,17-tetraen-14-yl] acetate (PubChem CID 58259517) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is [(1S,3S,4R,6S,7R,10S,11R)-10-hydroxy-5-methyl-12-oxa-5-azahexacyclo[9.7.0.01,7.03,17.04,6.013,18]octadeca-8,13,15,17-tetraen-14-yl] acetate.
| Compound Name | [(1S,3S,4R,6S,7R,10S,11R)-10-hydroxy-5-methyl-12-oxa-5-azahexacyclo[9.7.0.01,7.03,17.04,6.013,18]octadeca-8,13,15,17-tetraen-14-yl] acetate |
|---|---|
| PubChem CID | 58259517 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(1S,3S,4R,6S,7R,10S,11R)-10-hydroxy-5-methyl-12-oxa-5-azahexacyclo[9.7.0.01,7.03,17.04,6.013,18]octadeca-8,13,15,17-tetraen-14-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](O)C=C[C@H]4[C@H]5[C@@H]([C@H]2C[C@@]341)N5C |
| InChI | InChI=1S/C19H19NO4/c1-8(21)23-13-6-3-9-10-7-19-11(16-15(10)20(16)2)4-5-12(22)18(19)24-17(13)14(9)19/h3-6,10-12,15-16,18,22H,7H2,1-2H3/t10-,11-,12-,15+,16-,18-,19-,20?/m0/s1 |
| InChIKey | HBSHGLNPHAHAHN-PRJFWYCBSA-N |
| XLogP | 1.34 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|