C41H48O7 — CID 58260164
[4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-(hydroxymethyl)phenyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 58260164) has the molecular formula C41H48O7 and a molecular weight of 652.83 g/mol. Its IUPAC name is [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-(hydroxymethyl)phenyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-(hydroxymethyl)phenyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 58260164 |
| Molecular Formula | C41H48O7 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-(hydroxymethyl)phenyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)Oc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)cc1CO |
| InChI | InChI=1S/C41H48O7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-41(46)48-39-28-24-33(29-35(39)32-42)21-25-36(43)31-37(44)26-22-34-23-27-38(45)40(30-34)47-2/h4-5,7-8,10-11,13-14,16-17,21-30,42,45H,3,6,9,12,15,18-20,31-32H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,25-21+,26-22+ |
| InChIKey | WCVCWTZLGAIJOD-VZGJDAOWSA-N |
| XLogP | 8.98 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|