C19H27NO4-2 — CID 58272024
2-methyl-4-[4-[2-(2-oxopropoxy)ethyl-propylamino]phenyl]cyclobutane-1,3-diolate (PubChem CID 58272024) has the molecular formula C19H27NO4-2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-methyl-4-[4-[2-(2-oxopropoxy)ethyl-propylamino]phenyl]cyclobutane-1,3-diolate.
| Compound Name | 2-methyl-4-[4-[2-(2-oxopropoxy)ethyl-propylamino]phenyl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 58272024 |
| Molecular Formula | C19H27NO4-2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-methyl-4-[4-[2-(2-oxopropoxy)ethyl-propylamino]phenyl]cyclobutane-1,3-diolate |
| SMILES | CCCN(CCOCC(C)=O)c1ccc(C2C([O-])C(C)C2[O-])cc1 |
| InChI | InChI=1S/C19H27NO4/c1-4-9-20(10-11-24-12-13(2)21)16-7-5-15(6-8-16)17-18(22)14(3)19(17)23/h5-8,14,17-19H,4,9-12H2,1-3H3/q-2 |
| InChIKey | SMWNYDPQICCFGX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|