C11H16N4O — CID 58272030
5-[2-azidoethyl(ethyl)amino]-2-methylphenol (PubChem CID 58272030) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 5-[2-azidoethyl(ethyl)amino]-2-methylphenol.
| Compound Name | 5-[2-azidoethyl(ethyl)amino]-2-methylphenol |
|---|---|
| PubChem CID | 58272030 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5-[2-azidoethyl(ethyl)amino]-2-methylphenol |
| SMILES | CCN(CCN=[N+]=[N-])c1ccc(C)c(O)c1 |
| InChI | InChI=1S/C11H16N4O/c1-3-15(7-6-13-14-12)10-5-4-9(2)11(16)8-10/h4-5,8,16H,3,6-7H2,1-2H3 |
| InChIKey | UFKBNYSPWOGBKV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|