C18H18IrNO2S- — CID 58281681
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;(Z,4S)-pent-2-ene-2,4-diol (PubChem CID 58281681) has the molecular formula C18H18IrNO2S- and a molecular weight of 504.63 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;(Z,4S)-pent-2-ene-2,4-diol.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;(Z,4S)-pent-2-ene-2,4-diol |
|---|---|
| PubChem CID | 58281681 |
| Molecular Formula | C18H18IrNO2S- |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;(Z,4S)-pent-2-ene-2,4-diol |
| SMILES | C/C(O)=C/[C@H](C)O.[Ir].[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C13H8NS.C5H10O2.Ir/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;1-4(6)3-5(2)7;/h1-8H;3-4,6-7H,1-2H3;/q-1;;/b;5-3-;/t;4-;/m.0./s1 |
| InChIKey | LOUZTXGMRWTQNJ-FDEMVZSHSA-N |
| XLogP | 4.59 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|