C28H33N7O2 — CID 58282867
1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 58282867) has the molecular formula C28H33N7O2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 58282867 |
| Molecular Formula | C28H33N7O2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Cc3ccc(N4CCN(C)CC4)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C28H33N7O2/c1-5-13-34-27(36)22-19-29-24(18-20-9-11-21(12-10-20)33-16-14-32(4)15-17-33)31-26(22)35(34)25-8-6-7-23(30-25)28(2,3)37/h5-12,19,37H,1,13-18H2,2-4H3 |
| InChIKey | RIYGJLWWJJBHHK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|