About (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate
(1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (PubChem CID 58283076) has the molecular formula C13H23NO4S
and a molecular weight of 289.40 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
Analyze (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The IUPAC name of (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (CID 58283076) is (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
What is the SMILES notation for (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The canonical SMILES for (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate is CC1(OC(=O)CN2CCS(=O)(=O)CC2)CCCCC1.
What is the InChIKey of (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The InChIKey is JZJLJQDFEYHMCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4S/c1-13(5-3-2-4-6-13)18-12(15)11-14-7-9-19(16,17)10-8-14/h2-11H2,1H3.
What are the key properties of (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
(1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate has a molecular weight of 289.40 g/mol, XLogP of 0.98, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate is sourced from PubChem (CID 58283076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).