C14H25NO4S — CID 58283378
(1-ethylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (PubChem CID 58283378) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
| Compound Name | (1-ethylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate |
|---|---|
| PubChem CID | 58283378 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (1-ethylcyclohexyl) 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate |
| SMILES | CCC1(OC(=O)CN2CCS(=O)(=O)CC2)CCCCC1 |
| InChI | InChI=1S/C14H25NO4S/c1-2-14(6-4-3-5-7-14)19-13(16)12-15-8-10-20(17,18)11-9-15/h2-12H2,1H3 |
| InChIKey | IMFXOFQSBLMORB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |