C23H23ClN6O2 — CID 58289756
4-[2-[2-[3-[(5-chlorobenzotriazol-1-yl)methyl]phenyl]pyrimidin-5-yl]oxyethyl]morpholine (PubChem CID 58289756) has the molecular formula C23H23ClN6O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is 4-[2-[2-[3-[(5-chlorobenzotriazol-1-yl)methyl]phenyl]pyrimidin-5-yl]oxyethyl]morpholine.
| Compound Name | 4-[2-[2-[3-[(5-chlorobenzotriazol-1-yl)methyl]phenyl]pyrimidin-5-yl]oxyethyl]morpholine |
|---|---|
| PubChem CID | 58289756 |
| Molecular Formula | C23H23ClN6O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 4-[2-[2-[3-[(5-chlorobenzotriazol-1-yl)methyl]phenyl]pyrimidin-5-yl]oxyethyl]morpholine |
| SMILES | Clc1ccc2c(c1)nnn2Cc1cccc(-c2ncc(OCCN3CCOCC3)cn2)c1 |
| InChI | InChI=1S/C23H23ClN6O2/c24-19-4-5-22-21(13-19)27-28-30(22)16-17-2-1-3-18(12-17)23-25-14-20(15-26-23)32-11-8-29-6-9-31-10-7-29/h1-5,12-15H,6-11,16H2 |
| InChIKey | VOXDGMYBKBCNRG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |