C26H31N5O4S — CID 58289700
N-[[3-[5-(2-morpholin-4-ylethoxy)pyrimidin-2-yl]phenyl]methyl]-2-nitro-5-propylsulfanylaniline (PubChem CID 58289700) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is N-[[3-[5-(2-morpholin-4-ylethoxy)pyrimidin-2-yl]phenyl]methyl]-2-nitro-5-propylsulfanylaniline.
| Compound Name | N-[[3-[5-(2-morpholin-4-ylethoxy)pyrimidin-2-yl]phenyl]methyl]-2-nitro-5-propylsulfanylaniline |
|---|---|
| PubChem CID | 58289700 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[[3-[5-(2-morpholin-4-ylethoxy)pyrimidin-2-yl]phenyl]methyl]-2-nitro-5-propylsulfanylaniline |
| SMILES | CCCSc1ccc([N+](=O)[O-])c(NCc2cccc(-c3ncc(OCCN4CCOCC4)cn3)c2)c1 |
| InChI | InChI=1S/C26H31N5O4S/c1-2-14-36-23-6-7-25(31(32)33)24(16-23)27-17-20-4-3-5-21(15-20)26-28-18-22(19-29-26)35-13-10-30-8-11-34-12-9-30/h3-7,15-16,18-19,27H,2,8-14,17H2,1H3 |
| InChIKey | FJZCBEREXYJSDA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|