C17H21Cl2N3O2 — CID 66985501
4-[2-[2-[3-(chloromethyl)phenyl]pyrimidin-5-yl]oxyethyl]morpholine;hydrochloride (PubChem CID 66985501) has the molecular formula C17H21Cl2N3O2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 4-[2-[2-[3-(chloromethyl)phenyl]pyrimidin-5-yl]oxyethyl]morpholine;hydrochloride.
| Compound Name | 4-[2-[2-[3-(chloromethyl)phenyl]pyrimidin-5-yl]oxyethyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 66985501 |
| Molecular Formula | C17H21Cl2N3O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-[2-[2-[3-(chloromethyl)phenyl]pyrimidin-5-yl]oxyethyl]morpholine;hydrochloride |
| SMILES | Cl.ClCc1cccc(-c2ncc(OCCN3CCOCC3)cn2)c1 |
| InChI | InChI=1S/C17H20ClN3O2.ClH/c18-11-14-2-1-3-15(10-14)17-19-12-16(13-20-17)23-9-6-21-4-7-22-8-5-21;/h1-3,10,12-13H,4-9,11H2;1H |
| InChIKey | KGLDLKCIWXJUHS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|