C21H22ClN7O3- — CID 58289690
CID 58289690 (PubChem CID 58289690) has the molecular formula C21H22ClN7O3- and a molecular weight of 455.91 g/mol.
| Compound Name | CID 58289690 |
|---|---|
| PubChem CID | 58289690 |
| Molecular Formula | C21H22ClN7O3- |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | — |
| SMILES | [O-][N]c1cnc(Cl)nc1NCc1cccc(-c2ncc(OCCN3CCOCC3)cn2)c1 |
| InChI | InChI=1S/C21H22ClN7O3/c22-21-26-14-18(28-30)20(27-21)23-11-15-2-1-3-16(10-15)19-24-12-17(13-25-19)32-9-6-29-4-7-31-8-5-29/h1-3,10,12-14H,4-9,11H2,(H,23,26,27)/q-1 |
| InChIKey | GYEBCHUYYFSXAH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|