C21H26N2O5S — CID 58291882
ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 58291882) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58291882 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CCC1(C(=O)OCC)CCC(NS(=O)(=O)c2ccc(-c3cocn3)cc2)CC1 |
| InChI | InChI=1S/C21H26N2O5S/c1-3-11-21(20(24)28-4-2)12-9-17(10-13-21)23-29(25,26)18-7-5-16(6-8-18)19-14-27-15-22-19/h3,5-8,14-15,17,23H,1,4,9-13H2,2H3 |
| InChIKey | NZBYTSKQHOGNRQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|