About ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate
ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 58291882) has the molecular formula C21H26N2O5S
and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate |
| PubChem CID | 58291882 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CCC1(C(=O)OCC)CCC(NS(=O)(=O)c2ccc(-c3cocn3)cc2)CC1 |
| InChI | InChI=1S/C21H26N2O5S/c1-3-11-21(20(24)28-4-2)12-9-17(10-13-21)23-29(25,26)18-7-5-16(6-8-18)19-14-27-15-22-19/h3,5-8,14-15,17,23H,1,4,9-13H2,2H3 |
| InChIKey | NZBYTSKQHOGNRQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate (CID 58291882) is ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate is C=CCC1(C(=O)OCC)CCC(NS(=O)(=O)c2ccc(-c3cocn3)cc2)CC1.
What is the InChIKey of ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate?
The InChIKey is NZBYTSKQHOGNRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O5S/c1-3-11-21(20(24)28-4-2)12-9-17(10-13-21)23-29(25,26)18-7-5-16(6-8-18)19-14-27-15-22-19/h3,5-8,14-15,17,23H,1,4,9-13H2,2H3.
What are the key properties of ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate?
ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate has a molecular weight of 418.52 g/mol, XLogP of 3.69, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[4-(1,3-oxazol-4-yl)phenyl]sulfonylamino]-1-prop-2-enylcyclohexane-1-carboxylate is sourced from PubChem (CID 58291882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).