C9H16O — CID 58293720
(5Z)-2,3-dimethyl-3,4,7,8-tetrahydro-2H-oxocine (PubChem CID 58293720) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (5Z)-2,3-dimethyl-3,4,7,8-tetrahydro-2H-oxocine.
| Compound Name | (5Z)-2,3-dimethyl-3,4,7,8-tetrahydro-2H-oxocine |
|---|---|
| PubChem CID | 58293720 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (5Z)-2,3-dimethyl-3,4,7,8-tetrahydro-2H-oxocine |
| SMILES | CC1C/C=C\CCOC1C |
| InChI | InChI=1S/C9H16O/c1-8-6-4-3-5-7-10-9(8)2/h3-4,8-9H,5-7H2,1-2H3/b4-3- |
| InChIKey | FMNSYVCHZAMYQL-ARJAWSKDSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|