C27H39N5OS — CID 58300385
4-[5-(dipropylamino)pentylsulfanyl]-N-(1H-imidazol-2-ylmethyl)-N-(3H-pyrrol-2-ylmethyl)benzamide (PubChem CID 58300385) has the molecular formula C27H39N5OS and a molecular weight of 481.71 g/mol. Its IUPAC name is 4-[5-(dipropylamino)pentylsulfanyl]-N-(1H-imidazol-2-ylmethyl)-N-(3H-pyrrol-2-ylmethyl)benzamide.
| Compound Name | 4-[5-(dipropylamino)pentylsulfanyl]-N-(1H-imidazol-2-ylmethyl)-N-(3H-pyrrol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 58300385 |
| Molecular Formula | C27H39N5OS |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 4-[5-(dipropylamino)pentylsulfanyl]-N-(1H-imidazol-2-ylmethyl)-N-(3H-pyrrol-2-ylmethyl)benzamide |
| SMILES | CCCN(CCC)CCCCCSc1ccc(C(=O)N(CC2=NC=CC2)Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C27H39N5OS/c1-3-17-31(18-4-2)19-6-5-7-20-34-25-12-10-23(11-13-25)27(33)32(21-24-9-8-14-28-24)22-26-29-15-16-30-26/h8,10-16H,3-7,9,17-22H2,1-2H3,(H,29,30) |
| InChIKey | NDFBRQUNTMKCIW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|