C26H37N7O2 — CID 59649548
1-N-[4-(dipropylamino)butyl]-4-N,4-N-bis(1H-imidazol-2-ylmethyl)benzene-1,4-dicarboxamide (PubChem CID 59649548) has the molecular formula C26H37N7O2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 1-N-[4-(dipropylamino)butyl]-4-N,4-N-bis(1H-imidazol-2-ylmethyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-[4-(dipropylamino)butyl]-4-N,4-N-bis(1H-imidazol-2-ylmethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 59649548 |
| Molecular Formula | C26H37N7O2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | 1-N-[4-(dipropylamino)butyl]-4-N,4-N-bis(1H-imidazol-2-ylmethyl)benzene-1,4-dicarboxamide |
| SMILES | CCCN(CCC)CCCCNC(=O)c1ccc(C(=O)N(Cc2ncc[nH]2)Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C26H37N7O2/c1-3-16-32(17-4-2)18-6-5-11-31-25(34)21-7-9-22(10-8-21)26(35)33(19-23-27-12-13-28-23)20-24-29-14-15-30-24/h7-10,12-15H,3-6,11,16-20H2,1-2H3,(H,27,28)(H,29,30)(H,31,34) |
| InChIKey | RMLKIZXMTRZHMX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|