C25H37N7O3S — CID 67163752
4-[4-[di(propan-2-yl)amino]butylsulfamoyl]-N,N-bis(1H-imidazol-2-ylmethyl)benzamide (PubChem CID 67163752) has the molecular formula C25H37N7O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is 4-[4-[di(propan-2-yl)amino]butylsulfamoyl]-N,N-bis(1H-imidazol-2-ylmethyl)benzamide.
| Compound Name | 4-[4-[di(propan-2-yl)amino]butylsulfamoyl]-N,N-bis(1H-imidazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 67163752 |
| Molecular Formula | C25H37N7O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | 4-[4-[di(propan-2-yl)amino]butylsulfamoyl]-N,N-bis(1H-imidazol-2-ylmethyl)benzamide |
| SMILES | CC(C)N(CCCCNS(=O)(=O)c1ccc(C(=O)N(Cc2ncc[nH]2)Cc2ncc[nH]2)cc1)C(C)C |
| InChI | InChI=1S/C25H37N7O3S/c1-19(2)32(20(3)4)16-6-5-11-30-36(34,35)22-9-7-21(8-10-22)25(33)31(17-23-26-12-13-27-23)18-24-28-14-15-29-24/h7-10,12-15,19-20,30H,5-6,11,16-18H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | DHNPJVQGAMHJJM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|