C22H38N2O — CID 123149728
4-(2,2-dimethylpropyl)-N-[4-(dipropylamino)butyl]benzamide (PubChem CID 123149728) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-N-[4-(dipropylamino)butyl]benzamide.
| Compound Name | 4-(2,2-dimethylpropyl)-N-[4-(dipropylamino)butyl]benzamide |
|---|---|
| PubChem CID | 123149728 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-N-[4-(dipropylamino)butyl]benzamide |
| SMILES | CCCN(CCC)CCCCNC(=O)c1ccc(CC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H38N2O/c1-6-15-24(16-7-2)17-9-8-14-23-21(25)20-12-10-19(11-13-20)18-22(3,4)5/h10-13H,6-9,14-18H2,1-5H3,(H,23,25) |
| InChIKey | MNCTUZIIKGYWNQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|