C22H39N3O — CID 141125970
4-[(tert-butylamino)methyl]-N-[4-(dipropylamino)butyl]benzamide (PubChem CID 141125970) has the molecular formula C22H39N3O and a molecular weight of 361.57 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-N-[4-(dipropylamino)butyl]benzamide.
| Compound Name | 4-[(tert-butylamino)methyl]-N-[4-(dipropylamino)butyl]benzamide |
|---|---|
| PubChem CID | 141125970 |
| Molecular Formula | C22H39N3O |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.31 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-N-[4-(dipropylamino)butyl]benzamide |
| SMILES | CCCN(CCC)CCCCNC(=O)c1ccc(CNC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H39N3O/c1-6-15-25(16-7-2)17-9-8-14-23-21(26)20-12-10-19(11-13-20)18-24-22(3,4)5/h10-13,24H,6-9,14-18H2,1-5H3,(H,23,26) |
| InChIKey | YXFNYCJEBNBFIB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|