About (E,4S)-2-fluoro-4,5-dimethylhex-2-enal
(E,4S)-2-fluoro-4,5-dimethylhex-2-enal (PubChem CID 58304535) has the molecular formula C8H13FO
and a molecular weight of 144.19 g/mol. Its IUPAC name is (E,4S)-2-fluoro-4,5-dimethylhex-2-enal.
Molecular Properties
| Compound Name | (E,4S)-2-fluoro-4,5-dimethylhex-2-enal |
| PubChem CID | 58304535 |
| Molecular Formula | C8H13FO |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (E,4S)-2-fluoro-4,5-dimethylhex-2-enal |
| SMILES | CC(C)[C@H](C)/C=C(/F)C=O |
| InChI | InChI=1S/C8H13FO/c1-6(2)7(3)4-8(9)5-10/h4-7H,1-3H3/b8-4+/t7-/m1/s1 |
| InChIKey | XEIMSWKYKNJAHF-VKDKVYATSA-N |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,4S)-2-fluoro-4,5-dimethylhex-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4S)-2-fluoro-4,5-dimethylhex-2-enal?
The IUPAC name of (E,4S)-2-fluoro-4,5-dimethylhex-2-enal (CID 58304535) is (E,4S)-2-fluoro-4,5-dimethylhex-2-enal.
What is the SMILES notation for (E,4S)-2-fluoro-4,5-dimethylhex-2-enal?
The canonical SMILES for (E,4S)-2-fluoro-4,5-dimethylhex-2-enal is CC(C)[C@H](C)/C=C(/F)C=O.
What is the InChIKey of (E,4S)-2-fluoro-4,5-dimethylhex-2-enal?
The InChIKey is XEIMSWKYKNJAHF-VKDKVYATSA-N. The full InChI is InChI=1S/C8H13FO/c1-6(2)7(3)4-8(9)5-10/h4-7H,1-3H3/b8-4+/t7-/m1/s1.
What are the key properties of (E,4S)-2-fluoro-4,5-dimethylhex-2-enal?
(E,4S)-2-fluoro-4,5-dimethylhex-2-enal has a molecular weight of 144.19 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4S)-2-fluoro-4,5-dimethylhex-2-enal is sourced from PubChem (CID 58304535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).