C8H13FO — CID 58304535
(E,4S)-2-fluoro-4,5-dimethylhex-2-enal (PubChem CID 58304535) has the molecular formula C8H13FO and a molecular weight of 144.19 g/mol. Its IUPAC name is (E,4S)-2-fluoro-4,5-dimethylhex-2-enal.
| Compound Name | (E,4S)-2-fluoro-4,5-dimethylhex-2-enal |
|---|---|
| PubChem CID | 58304535 |
| Molecular Formula | C8H13FO |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (E,4S)-2-fluoro-4,5-dimethylhex-2-enal |
| SMILES | CC(C)[C@H](C)/C=C(/F)C=O |
| InChI | InChI=1S/C8H13FO/c1-6(2)7(3)4-8(9)5-10/h4-7H,1-3H3/b8-4+/t7-/m1/s1 |
| InChIKey | XEIMSWKYKNJAHF-VKDKVYATSA-N |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|