C11H19FO — CID 58305104
(4E,7Z)-5-fluoroundeca-4,7-dien-6-ol (PubChem CID 58305104) has the molecular formula C11H19FO and a molecular weight of 186.27 g/mol. Its IUPAC name is (4E,7Z)-5-fluoroundeca-4,7-dien-6-ol.
| Compound Name | (4E,7Z)-5-fluoroundeca-4,7-dien-6-ol |
|---|---|
| PubChem CID | 58305104 |
| Molecular Formula | C11H19FO |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (4E,7Z)-5-fluoroundeca-4,7-dien-6-ol |
| SMILES | CCC/C=C\C(O)/C(F)=C\CCC |
| InChI | InChI=1S/C11H19FO/c1-3-5-7-9-11(13)10(12)8-6-4-2/h7-9,11,13H,3-6H2,1-2H3/b9-7-,10-8+ |
| InChIKey | WHLWKJWKWAOBSE-FKJILZIQSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|