C26H40N2O4 — CID 58311069
2-hydroxy-2-[(3S,8E,14R,17S,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]acetonitrile (PubChem CID 58311069) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is 2-hydroxy-2-[(3S,8E,14R,17S,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]acetonitrile.
| Compound Name | 2-hydroxy-2-[(3S,8E,14R,17S,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]acetonitrile |
|---|---|
| PubChem CID | 58311069 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 2-hydroxy-2-[(3S,8E,14R,17S,18R)-3,20,20-trimethyl-2,16-dioxo-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-en-14-yl]acetonitrile |
| SMILES | C[C@H]1CCCC/C=C/CCCC[C@@H](C(O)C#N)CC(=O)[C@@H]2[C@H]3CC(C)(C)OC3CN2C1=O |
| InChI | InChI=1S/C26H40N2O4/c1-18-12-10-8-6-4-5-7-9-11-13-19(22(30)16-27)14-21(29)24-20-15-26(2,3)32-23(20)17-28(24)25(18)31/h4-5,18-20,22-24,30H,6-15,17H2,1-3H3/b5-4+/t18-,19+,20-,22?,23?,24-/m0/s1 |
| InChIKey | RJVVBAFNCGFXAA-UBKDRCCGSA-N |
| XLogP | 4.17 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|