C25H41NO4 — CID 58311325
(3S,8E,14R,17S,18R)-14-(hydroxymethyl)-3,20,20-trimethyl-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-ene-2,16-dione (PubChem CID 58311325) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is (3S,8E,14R,17S,18R)-14-(hydroxymethyl)-3,20,20-trimethyl-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-ene-2,16-dione.
| Compound Name | (3S,8E,14R,17S,18R)-14-(hydroxymethyl)-3,20,20-trimethyl-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-ene-2,16-dione |
|---|---|
| PubChem CID | 58311325 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | (3S,8E,14R,17S,18R)-14-(hydroxymethyl)-3,20,20-trimethyl-21-oxa-1-azatricyclo[15.6.0.018,22]tricos-8-ene-2,16-dione |
| SMILES | C[C@H]1CCCC/C=C/CCCC[C@@H](CO)CC(=O)[C@@H]2[C@H]3CC(C)(C)OC3CN2C1=O |
| InChI | InChI=1S/C25H41NO4/c1-18-12-10-8-6-4-5-7-9-11-13-19(17-27)14-21(28)23-20-15-25(2,3)30-22(20)16-26(23)24(18)29/h4-5,18-20,22-23,27H,6-17H2,1-3H3/b5-4+/t18-,19+,20-,22?,23-/m0/s1 |
| InChIKey | RBBATJFBOQPRDN-UWIPZYGXSA-N |
| XLogP | 4.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|